C10H10ClF5N2 — CID 171194542
(2R)-2-(2,3,4,5,6-pentafluorophenyl)piperazine;hydrochloride (PubChem CID 171194542) has the molecular formula C10H10ClF5N2 and a molecular weight of 288.65 g/mol. Its IUPAC name is (2R)-2-(2,3,4,5,6-pentafluorophenyl)piperazine;hydrochloride.
| Compound Name | (2R)-2-(2,3,4,5,6-pentafluorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 171194542 |
| Molecular Formula | C10H10ClF5N2 |
| Molecular Weight | 288.65 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (2R)-2-(2,3,4,5,6-pentafluorophenyl)piperazine;hydrochloride |
| SMILES | Cl.Fc1c(F)c(F)c([C@@H]2CNCCN2)c(F)c1F |
| InChI | InChI=1S/C10H9F5N2.ClH/c11-6-5(4-3-16-1-2-17-4)7(12)9(14)10(15)8(6)13;/h4,16-17H,1-3H2;1H/t4-;/m0./s1 |
| InChIKey | UUWQSXRDJJKADJ-WCCKRBBISA-N |
| XLogP | 2.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|