C10H11BrF2N2 — CID 131548332
(2S)-2-(3-bromo-2,6-difluorophenyl)piperazine (PubChem CID 131548332) has the molecular formula C10H11BrF2N2 and a molecular weight of 277.11 g/mol. Its IUPAC name is (2S)-2-(3-bromo-2,6-difluorophenyl)piperazine.
| Compound Name | (2S)-2-(3-bromo-2,6-difluorophenyl)piperazine |
|---|---|
| PubChem CID | 131548332 |
| Molecular Formula | C10H11BrF2N2 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (2S)-2-(3-bromo-2,6-difluorophenyl)piperazine |
| SMILES | Fc1ccc(Br)c(F)c1[C@H]1CNCCN1 |
| InChI | InChI=1S/C10H11BrF2N2/c11-6-1-2-7(12)9(10(6)13)8-5-14-3-4-15-8/h1-2,8,14-15H,3-5H2/t8-/m1/s1 |
| InChIKey | HOOFGKOATHOKJE-MRVPVSSYSA-N |
| XLogP | 1.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|