C10H11Cl2FN2 — CID 171194726
(2R)-2-(3,6-dichloro-2-fluorophenyl)piperazine (PubChem CID 171194726) has the molecular formula C10H11Cl2FN2 and a molecular weight of 249.12 g/mol. Its IUPAC name is (2R)-2-(3,6-dichloro-2-fluorophenyl)piperazine.
| Compound Name | (2R)-2-(3,6-dichloro-2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 171194726 |
| Molecular Formula | C10H11Cl2FN2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | (2R)-2-(3,6-dichloro-2-fluorophenyl)piperazine |
| SMILES | Fc1c(Cl)ccc(Cl)c1[C@@H]1CNCCN1 |
| InChI | InChI=1S/C10H11Cl2FN2/c11-6-1-2-7(12)10(13)9(6)8-5-14-3-4-15-8/h1-2,8,14-15H,3-5H2/t8-/m0/s1 |
| InChIKey | SJWQIGSXLQDHHM-QMMMGPOBSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|