C10H11Cl2F2N — CID 171196413
(2S)-2-(3-chloro-2,6-difluorophenyl)pyrrolidine;hydrochloride (PubChem CID 171196413) has the molecular formula C10H11Cl2F2N and a molecular weight of 254.11 g/mol. Its IUPAC name is (2S)-2-(3-chloro-2,6-difluorophenyl)pyrrolidine;hydrochloride.
| Compound Name | (2S)-2-(3-chloro-2,6-difluorophenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 171196413 |
| Molecular Formula | C10H11Cl2F2N |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | (2S)-2-(3-chloro-2,6-difluorophenyl)pyrrolidine;hydrochloride |
| SMILES | Cl.Fc1ccc(Cl)c(F)c1[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H10ClF2N.ClH/c11-6-3-4-7(12)9(10(6)13)8-2-1-5-14-8;/h3-4,8,14H,1-2,5H2;1H/t8-;/m0./s1 |
| InChIKey | IMKJGKPNEZZEMV-QRPNPIFTSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|