C11H13F2NS — CID 117330920
2-(2,6-difluoro-3-methylsulfanylphenyl)pyrrolidine (PubChem CID 117330920) has the molecular formula C11H13F2NS and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-methylsulfanylphenyl)pyrrolidine.
| Compound Name | 2-(2,6-difluoro-3-methylsulfanylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 117330920 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(2,6-difluoro-3-methylsulfanylphenyl)pyrrolidine |
| SMILES | CSc1ccc(F)c(C2CCCN2)c1F |
| InChI | InChI=1S/C11H13F2NS/c1-15-9-5-4-7(12)10(11(9)13)8-3-2-6-14-8/h4-5,8,14H,2-3,6H2,1H3 |
| InChIKey | TXXOTHYBBUIXMX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |