C10H9ClF5N — CID 171196031
(2R)-2-(2,3,4,5,6-pentafluorophenyl)pyrrolidine;hydrochloride (PubChem CID 171196031) has the molecular formula C10H9ClF5N and a molecular weight of 273.63 g/mol. Its IUPAC name is (2R)-2-(2,3,4,5,6-pentafluorophenyl)pyrrolidine;hydrochloride.
| Compound Name | (2R)-2-(2,3,4,5,6-pentafluorophenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 171196031 |
| Molecular Formula | C10H9ClF5N |
| Molecular Weight | 273.63 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (2R)-2-(2,3,4,5,6-pentafluorophenyl)pyrrolidine;hydrochloride |
| SMILES | Cl.Fc1c(F)c(F)c([C@H]2CCCN2)c(F)c1F |
| InChI | InChI=1S/C10H8F5N.ClH/c11-6-5(4-2-1-3-16-4)7(12)9(14)10(15)8(6)13;/h4,16H,1-3H2;1H/t4-;/m1./s1 |
| InChIKey | FEUWSADVJRCSBZ-PGMHMLKASA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|