C25H35NO2 — CID 102275565
2,4-ditert-butyl-6-[(2R,4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenol (PubChem CID 102275565) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2R,4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2R,4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenol |
|---|---|
| PubChem CID | 102275565 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2R,4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[C@H](c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)N1C |
| InChI | InChI=1S/C25H35NO2/c1-16-22(17-12-10-9-11-13-17)28-23(26(16)8)19-14-18(24(2,3)4)15-20(21(19)27)25(5,6)7/h9-16,22-23,27H,1-8H3/t16-,22-,23+/m0/s1 |
| InChIKey | TUACIFAJLVRWIZ-IRBZQWRBSA-N |
| XLogP | 6.08 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|