C21H26N2O2 — CID 125027394
4-[4-[(2S,4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenyl]morpholine (PubChem CID 125027394) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[4-[(2S,4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenyl]morpholine.
| Compound Name | 4-[4-[(2S,4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 125027394 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[4-[(2S,4R,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]phenyl]morpholine |
| SMILES | C[C@@H]1[C@H](c2ccccc2)O[C@@H](c2ccc(N3CCOCC3)cc2)N1C |
| InChI | InChI=1S/C21H26N2O2/c1-16-20(17-6-4-3-5-7-17)25-21(22(16)2)18-8-10-19(11-9-18)23-12-14-24-15-13-23/h3-11,16,20-21H,12-15H2,1-2H3/t16-,20-,21+/m1/s1 |
| InChIKey | GPVLWMWZMUZIJB-HBGVWJBISA-N |
| XLogP | 3.61 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|