C19H24N2O — CID 74028862
4-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)-N,N-dimethylaniline (PubChem CID 74028862) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 74028862 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 4-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)-N,N-dimethylaniline |
| SMILES | CC1C(c2ccccc2)OC(c2ccc(N(C)C)cc2)N1C |
| InChI | InChI=1S/C19H24N2O/c1-14-18(15-8-6-5-7-9-15)22-19(21(14)4)16-10-12-17(13-11-16)20(2)3/h5-14,18-19H,1-4H3 |
| InChIKey | BSAVMZXMIYLXLG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|