C28H29NO — CID 11349970
(2R,3S,5R,6S)-3,4-dimethyl-2-phenyl-5,6-bis[(E)-2-phenylethenyl]morpholine (PubChem CID 11349970) has the molecular formula C28H29NO and a molecular weight of 395.55 g/mol. Its IUPAC name is (2R,3S,5R,6S)-3,4-dimethyl-2-phenyl-5,6-bis[(E)-2-phenylethenyl]morpholine.
| Compound Name | (2R,3S,5R,6S)-3,4-dimethyl-2-phenyl-5,6-bis[(E)-2-phenylethenyl]morpholine |
|---|---|
| PubChem CID | 11349970 |
| Molecular Formula | C28H29NO |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (2R,3S,5R,6S)-3,4-dimethyl-2-phenyl-5,6-bis[(E)-2-phenylethenyl]morpholine |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[C@@H](/C=C/c2ccccc2)[C@@H](/C=C/c2ccccc2)N1C |
| InChI | InChI=1S/C28H29NO/c1-22-28(25-16-10-5-11-17-25)30-27(21-19-24-14-8-4-9-15-24)26(29(22)2)20-18-23-12-6-3-7-13-23/h3-22,26-28H,1-2H3/b20-18+,21-19+/t22-,26+,27-,28-/m0/s1 |
| InChIKey | NXIWXXWNCKRRJX-NDGSWSFESA-N |
| XLogP | 6.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |