C29H27OP — CID 134876536
(3R,4R)-3-methyl-2,2,2-triphenyl-4-[(E)-2-phenylethenyl]-1,2λ5-oxaphosphetane (PubChem CID 134876536) has the molecular formula C29H27OP and a molecular weight of 422.51 g/mol. Its IUPAC name is (3R,4R)-3-methyl-2,2,2-triphenyl-4-[(E)-2-phenylethenyl]-1,2λ5-oxaphosphetane.
| Compound Name | (3R,4R)-3-methyl-2,2,2-triphenyl-4-[(E)-2-phenylethenyl]-1,2λ5-oxaphosphetane |
|---|---|
| PubChem CID | 134876536 |
| Molecular Formula | C29H27OP |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (3R,4R)-3-methyl-2,2,2-triphenyl-4-[(E)-2-phenylethenyl]-1,2λ5-oxaphosphetane |
| SMILES | C[C@@H]1[C@@H](/C=C/c2ccccc2)OP1(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27OP/c1-24-29(23-22-25-14-6-2-7-15-25)30-31(24,26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-24,29H,1H3/b23-22+/t24-,29-/m1/s1 |
| InChIKey | CBRBCIFNAGJRQS-VJZSZMDCSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|