C17H18O2 — CID 102338797
(1R,3S,4R,5R,7R)-7-ethynyl-4-methyl-3-[(E)-2-phenylethenyl]-2,6-dioxabicyclo[3.2.1]octane (PubChem CID 102338797) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1R,3S,4R,5R,7R)-7-ethynyl-4-methyl-3-[(E)-2-phenylethenyl]-2,6-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,3S,4R,5R,7R)-7-ethynyl-4-methyl-3-[(E)-2-phenylethenyl]-2,6-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 102338797 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1R,3S,4R,5R,7R)-7-ethynyl-4-methyl-3-[(E)-2-phenylethenyl]-2,6-dioxabicyclo[3.2.1]octane |
| SMILES | C#C[C@H]1O[C@@H]2C[C@H]1O[C@@H](/C=C/c1ccccc1)[C@@H]2C |
| InChI | InChI=1S/C17H18O2/c1-3-14-17-11-16(18-14)12(2)15(19-17)10-9-13-7-5-4-6-8-13/h1,4-10,12,14-17H,11H2,2H3/b10-9+/t12-,14+,15-,16+,17+/m0/s1 |
| InChIKey | MVTIBWCSLSONPH-MBTJNXJPSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|