C14H14O2 — CID 102575630
(3aS,5S,6aS)-5-[(E)-2-phenylethenyl]-3a,5,6,6a-tetrahydrofuro[3,2-b]furan (PubChem CID 102575630) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3aS,5S,6aS)-5-[(E)-2-phenylethenyl]-3a,5,6,6a-tetrahydrofuro[3,2-b]furan.
| Compound Name | (3aS,5S,6aS)-5-[(E)-2-phenylethenyl]-3a,5,6,6a-tetrahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 102575630 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (3aS,5S,6aS)-5-[(E)-2-phenylethenyl]-3a,5,6,6a-tetrahydrofuro[3,2-b]furan |
| SMILES | C1=C[C@@H]2O[C@H](/C=C/c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C14H14O2/c1-2-4-11(5-3-1)6-7-12-10-14-13(16-12)8-9-15-14/h1-9,12-14H,10H2/b7-6+/t12-,13+,14+/m1/s1 |
| InChIKey | SLRXPGHVVGEODU-XURUEHEKSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |