C13H12O2 — CID 11229405
(2S)-2-[(Z)-2-phenylethenyl]-2,3-dihydropyran-6-one (PubChem CID 11229405) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (2S)-2-[(Z)-2-phenylethenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(Z)-2-phenylethenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11229405 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (2S)-2-[(Z)-2-phenylethenyl]-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CC[C@@H](/C=C\c2ccccc2)O1 |
| InChI | InChI=1S/C13H12O2/c14-13-8-4-7-12(15-13)10-9-11-5-2-1-3-6-11/h1-6,8-10,12H,7H2/b10-9-/t12-/m0/s1 |
| InChIKey | RLGHFVLWYYVMQZ-PRDAAYKISA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |