C19H22O5 — CID 101052051
(2R)-2-[[(2S,4R,5R,6R)-4,5-dihydroxy-6-[(E)-2-phenylethenyl]oxan-2-yl]methyl]-2,3-dihydropyran-6-one (PubChem CID 101052051) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2R)-2-[[(2S,4R,5R,6R)-4,5-dihydroxy-6-[(E)-2-phenylethenyl]oxan-2-yl]methyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[[(2S,4R,5R,6R)-4,5-dihydroxy-6-[(E)-2-phenylethenyl]oxan-2-yl]methyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 101052051 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2R)-2-[[(2S,4R,5R,6R)-4,5-dihydroxy-6-[(E)-2-phenylethenyl]oxan-2-yl]methyl]-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CC[C@H](C[C@@H]2C[C@@H](O)[C@@H](O)[C@@H](/C=C/c3ccccc3)O2)O1 |
| InChI | InChI=1S/C19H22O5/c20-16-12-15(11-14-7-4-8-18(21)24-14)23-17(19(16)22)10-9-13-5-2-1-3-6-13/h1-6,8-10,14-17,19-20,22H,7,11-12H2/b10-9+/t14-,15-,16-,17-,19-/m1/s1 |
| InChIKey | JKIRIPQYXPLBKK-HYGWSYKWSA-N |
| XLogP | 1.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |