C17H22O3 — CID 74817578
2-(2-hydroxy-6-phenylhexyl)-2,3-dihydropyran-6-one (PubChem CID 74817578) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(2-hydroxy-6-phenylhexyl)-2,3-dihydropyran-6-one.
| Compound Name | 2-(2-hydroxy-6-phenylhexyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 74817578 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-(2-hydroxy-6-phenylhexyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(CC(O)CCCCc2ccccc2)O1 |
| InChI | InChI=1S/C17H22O3/c18-15(13-16-11-6-12-17(19)20-16)10-5-4-9-14-7-2-1-3-8-14/h1-3,6-8,12,15-16,18H,4-5,9-11,13H2 |
| InChIKey | MSSPKNJNLJRUHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|