C23H30O6 — CID 162991391
[(3R,5R,7R)-5,7-dihydroxy-10-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-1-phenyldec-9-en-3-yl] acetate (PubChem CID 162991391) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(3R,5R,7R)-5,7-dihydroxy-10-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-1-phenyldec-9-en-3-yl] acetate.
| Compound Name | [(3R,5R,7R)-5,7-dihydroxy-10-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-1-phenyldec-9-en-3-yl] acetate |
|---|---|
| PubChem CID | 162991391 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(3R,5R,7R)-5,7-dihydroxy-10-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-1-phenyldec-9-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H](CCc1ccccc1)C[C@H](O)C[C@H](O)CC=C[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C23H30O6/c1-17(24)28-22(14-13-18-7-3-2-4-8-18)16-20(26)15-19(25)9-5-10-21-11-6-12-23(27)29-21/h2-8,10,12,19-22,25-26H,9,11,13-16H2,1H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | COTKLINVGAXUGW-GXRSIYKFSA-N |
| XLogP | 2.87 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|