C33H54O5Si2 — CID 134844585
(2R)-2-[(1E,4S,6R,8R,9E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-10-phenyldeca-1,9-dienyl]-2,3-dihydropyran-6-one (PubChem CID 134844585) has the molecular formula C33H54O5Si2 and a molecular weight of 586.96 g/mol. Its IUPAC name is (2R)-2-[(1E,4S,6R,8R,9E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-10-phenyldeca-1,9-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,4S,6R,8R,9E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-10-phenyldeca-1,9-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 134844585 |
| Molecular Formula | C33H54O5Si2 |
| Molecular Weight | 586.96 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | (2R)-2-[(1E,4S,6R,8R,9E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-10-phenyldeca-1,9-dienyl]-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C[C@@H](O)C/C=C/[C@H]1CC=CC(=O)O1)C[C@H](/C=C/c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H54O5Si2/c1-32(2,3)39(7,8)37-29(23-22-26-16-12-11-13-17-26)25-30(38-40(9,10)33(4,5)6)24-27(34)18-14-19-28-20-15-21-31(35)36-28/h11-17,19,21-23,27-30,34H,18,20,24-25H2,1-10H3/b19-14+,23-22+/t27-,28-,29-,30+/m0/s1 |
| InChIKey | WNTBWUIKRWYCNE-GENIMMJQSA-N |
| XLogP | 8.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.96 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|