C32H61IO5Si3 — CID 11285603
(2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-3-methyl-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one (PubChem CID 11285603) has the molecular formula C32H61IO5Si3 and a molecular weight of 737.00 g/mol. Its IUPAC name is (2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-3-methyl-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-3-methyl-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11285603 |
| Molecular Formula | C32H61IO5Si3 |
| Molecular Weight | 737.00 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | (2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-8-iodo-3-methyl-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](/C=C\I)O[Si](C)(C)C(C)(C)C)[C@@](C)(/C=C/[C@H]1CC=CC(=O)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H61IO5Si3/c1-13-40(14-2,15-3)37-29(26-28(23-25-33)36-39(11,12)31(7,8)9)32(10,38-41(16-4,17-5)18-6)24-22-27-20-19-21-30(34)35-27/h19,21-25,27-29H,13-18,20,26H2,1-12H3/b24-22+,25-23-/t27-,28+,29-,32-/m1/s1 |
| InChIKey | UYQPAXQGJFPYMG-UCGBCGQDSA-N |
| XLogP | 10.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.00 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|