C19H28O6Si — CID 11234363
(2R)-2-[(E,3R,4R)-4-hydroxy-3-(methoxymethoxy)-3-methyl-6-oxo-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one (PubChem CID 11234363) has the molecular formula C19H28O6Si and a molecular weight of 380.51 g/mol. Its IUPAC name is (2R)-2-[(E,3R,4R)-4-hydroxy-3-(methoxymethoxy)-3-methyl-6-oxo-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E,3R,4R)-4-hydroxy-3-(methoxymethoxy)-3-methyl-6-oxo-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11234363 |
| Molecular Formula | C19H28O6Si |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2R)-2-[(E,3R,4R)-4-hydroxy-3-(methoxymethoxy)-3-methyl-6-oxo-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one |
| SMILES | COCO[C@](C)(/C=C/[C@H]1CC=CC(=O)O1)[C@H](O)CC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H28O6Si/c1-19(24-14-23-2,11-9-16-7-6-8-18(22)25-16)17(21)13-15(20)10-12-26(3,4)5/h6,8-9,11,16-17,21H,7,13-14H2,1-5H3/b11-9+/t16-,17-,19-/m1/s1 |
| InChIKey | RGMLBQFOSRDVQY-UGDDLLDRSA-N |
| XLogP | 1.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|