C20H30O5Si — CID 11268951
(2R)-2-[(E)-2-[(4R,5R)-5-[(2R)-2-hydroxy-4-trimethylsilylbut-3-ynyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one (PubChem CID 11268951) has the molecular formula C20H30O5Si and a molecular weight of 378.54 g/mol. Its IUPAC name is (2R)-2-[(E)-2-[(4R,5R)-5-[(2R)-2-hydroxy-4-trimethylsilylbut-3-ynyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E)-2-[(4R,5R)-5-[(2R)-2-hydroxy-4-trimethylsilylbut-3-ynyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11268951 |
| Molecular Formula | C20H30O5Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (2R)-2-[(E)-2-[(4R,5R)-5-[(2R)-2-hydroxy-4-trimethylsilylbut-3-ynyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one |
| SMILES | CC1(C)O[C@H](C[C@@H](O)C#C[Si](C)(C)C)[C@@](C)(/C=C/[C@H]2CC=CC(=O)O2)O1 |
| InChI | InChI=1S/C20H30O5Si/c1-19(2)24-17(14-15(21)11-13-26(4,5)6)20(3,25-19)12-10-16-8-7-9-18(22)23-16/h7,9-10,12,15-17,21H,8,14H2,1-6H3/b12-10+/t15-,16+,17+,20+/m0/s1 |
| InChIKey | DIWLHHQPBKEORI-GEDXHJSBSA-N |
| XLogP | 2.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|