C17H32O6Si — CID 10737266
methyl (Z)-3-[(4S,5R)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 10737266) has the molecular formula C17H32O6Si and a molecular weight of 360.52 g/mol. Its IUPAC name is methyl (Z)-3-[(4S,5R)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(4S,5R)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10737266 |
| Molecular Formula | C17H32O6Si |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | methyl (Z)-3-[(4S,5R)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O6Si/c1-16(2,3)24(7,8)21-11-12(18)15-13(9-10-14(19)20-6)22-17(4,5)23-15/h9-10,12-13,15,18H,11H2,1-8H3/b10-9-/t12-,13+,15-/m1/s1 |
| InChIKey | SOYPUQDOPLBZJS-ZIRCARBESA-N |
| XLogP | 2.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|