C15H30O5Si — CID 11290125
ethyl (E,4R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyhept-2-enoate (PubChem CID 11290125) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is ethyl (E,4R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyhept-2-enoate.
| Compound Name | ethyl (E,4R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyhept-2-enoate |
|---|---|
| PubChem CID | 11290125 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | ethyl (E,4R,5R)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O5Si/c1-7-19-14(18)9-8-12(16)13(17)10-11-20-21(5,6)15(2,3)4/h8-9,12-13,16-17H,7,10-11H2,1-6H3/b9-8+/t12-,13-/m1/s1 |
| InChIKey | BIZZWRWZFNZHHY-RYYBZQDPSA-N |
| XLogP | 2.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|