C16H28O6Si — CID 11416659
ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11416659) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11416659 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OC(=O)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O6Si/c1-7-19-14(17)9-8-12-13(22-15(18)21-12)10-11-20-23(5,6)16(2,3)4/h8-9,12-13H,7,10-11H2,1-6H3/b9-8+/t12-,13-/m1/s1 |
| InChIKey | CUZRXBSESLXVET-RYYBZQDPSA-N |
| XLogP | 3.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|