C19H36O6Si — CID 46894691
[(3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-5-en-3-yl] prop-2-enoate (PubChem CID 46894691) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is [(3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-5-en-3-yl] prop-2-enoate.
| Compound Name | [(3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-5-en-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 46894691 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [(3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-5-en-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](C=C)OCOCCOC |
| InChI | InChI=1S/C19H36O6Si/c1-9-16(23-15-22-14-13-21-6)17(25-18(20)10-2)11-12-24-26(7,8)19(3,4)5/h9-10,16-17H,1-2,11-15H2,3-8H3/t16-,17-/m1/s1 |
| InChIKey | BLRAQFWTRNBRQJ-IAGOWNOFSA-N |
| XLogP | 3.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|