C17H34O5Si — CID 134842529
ethyl (E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)hept-2-enoate (PubChem CID 134842529) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is ethyl (E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)hept-2-enoate.
| Compound Name | ethyl (E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)hept-2-enoate |
|---|---|
| PubChem CID | 134842529 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | ethyl (E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](OCOC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-9-20-16(18)12-10-11-15(21-13-19-6)14(2)22-23(7,8)17(3,4)5/h10,12,14-15H,9,11,13H2,1-8H3/b12-10+/t14-,15+/m0/s1 |
| InChIKey | QCZATLFJUGSOBW-LNKCYATRSA-N |
| XLogP | 3.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|