C16H30O6Si — CID 11791894
[(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate (PubChem CID 11791894) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is [(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate.
| Compound Name | [(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 11791894 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate |
| SMILES | CCO[C@@H]1C=C[C@H](OC(=O)OC)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H30O6Si/c1-8-19-14-10-9-12(22-15(17)18-5)13(21-14)11-20-23(6,7)16(2,3)4/h9-10,12-14H,8,11H2,1-7H3/t12-,13+,14-/m0/s1 |
| InChIKey | HMKZBMFEKXQADF-MJBXVCDLSA-N |
| XLogP | 3.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|