C16H31NO5Si — CID 11078492
[(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate (PubChem CID 11078492) has the molecular formula C16H31NO5Si and a molecular weight of 345.51 g/mol. Its IUPAC name is [(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate.
| Compound Name | [(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate |
|---|---|
| PubChem CID | 11078492 |
| Molecular Formula | C16H31NO5Si |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [(2S,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate |
| SMILES | CC(C)O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=C[C@H]1OC(N)=O |
| InChI | InChI=1S/C16H31NO5Si/c1-11(2)20-14-13(22-15(17)18)9-8-12(21-14)10-19-23(6,7)16(3,4)5/h8-9,11-14H,10H2,1-7H3,(H2,17,18)/t12-,13+,14-/m0/s1 |
| InChIKey | SCCWYCUNGCXLHN-MJBXVCDLSA-N |
| XLogP | 3.18 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|