C13H24O5Si — CID 102526053
[(3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate (PubChem CID 102526053) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is [(3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate.
| Compound Name | [(3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 102526053 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)OC1 |
| InChI | InChI=1S/C13H24O5Si/c1-13(2,3)19(5,6)18-11-8-7-10(9-16-11)17-12(14)15-4/h7-8,10-11H,9H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | YUZNMHCZRGSDQA-MNOVXSKESA-N |
| XLogP | 3.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|