C18H34O6Si — CID 5366515
methyl (E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 5366515) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is methyl (E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 5366515 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl (E)-3-[2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1OC(C)(C)OC1CC(C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C18H34O6Si/c1-14(22-13-21-10-11-25(5,6)7)12-16-15(8-9-17(19)20-4)23-18(2,3)24-16/h8-9,14-16H,10-13H2,1-7H3/b9-8+ |
| InChIKey | QOQDMLUGUHXQKJ-CMDGGOBGSA-N |
| XLogP | 3.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|