C24H44O7Si — CID 46218228
ethyl (E,5S,7R)-7-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoate (PubChem CID 46218228) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is ethyl (E,5S,7R)-7-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoate.
| Compound Name | ethyl (E,5S,7R)-7-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoate |
|---|---|
| PubChem CID | 46218228 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | ethyl (E,5S,7R)-7-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxy-5-(methoxymethoxy)oct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C[C@@H](C)OC(=O)/C=C/C[C@@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C24H44O7Si/c1-10-28-22(25)15-12-14-21(29-18-27-7)17-20(3)30-23(26)16-11-13-19(2)31-32(8,9)24(4,5)6/h11-12,15-16,19-21H,10,13-14,17-18H2,1-9H3/b15-12+,16-11+/t19-,20-,21+/m1/s1 |
| InChIKey | LFMQGYHEWUJOQM-SNHYNKRZSA-N |
| XLogP | 5.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|