C21H36O4Si — CID 11474485
(E)-3-[(4R,6S)-6-[(2Z,4E)-6-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enal (PubChem CID 11474485) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (E)-3-[(4R,6S)-6-[(2Z,4E)-6-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enal.
| Compound Name | (E)-3-[(4R,6S)-6-[(2Z,4E)-6-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enal |
|---|---|
| PubChem CID | 11474485 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (E)-3-[(4R,6S)-6-[(2Z,4E)-6-[tert-butyl(dimethyl)silyl]oxyhexa-2,4-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]prop-2-enal |
| SMILES | CC1(C)O[C@@H](C/C=C\C=C\CO[Si](C)(C)C(C)(C)C)C[C@H](/C=C/C=O)O1 |
| InChI | InChI=1S/C21H36O4Si/c1-20(2,3)26(6,7)23-16-11-9-8-10-13-18-17-19(14-12-15-22)25-21(4,5)24-18/h8-12,14-15,18-19H,13,16-17H2,1-7H3/b10-8-,11-9+,14-12+/t18-,19-/m0/s1 |
| InChIKey | PNIZSJUJUHJRRA-SSKGFADLSA-N |
| XLogP | 5.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|