C19H34O4Si — CID 135011565
6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 135011565) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is 6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 135011565 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C[C@H](CCC/C=C/C1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-15(23-24(7,8)18(2,3)4)12-10-9-11-13-16-14-17(20)22-19(5,6)21-16/h11,13-15H,9-10,12H2,1-8H3/b13-11+/t15-/m1/s1 |
| InChIKey | UUBOPUZMWORQJV-HFBDAHEESA-N |
| XLogP | 5.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|