About zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide
zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide (PubChem CID 177442884) has the molecular formula C16H32OSiZn
and a molecular weight of 333.91 g/mol. Its IUPAC name is zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide.
Molecular Properties
| Compound Name | zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide |
| PubChem CID | 177442884 |
| Molecular Formula | C16H32OSiZn |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide |
| SMILES | [CH3-].[H]/[C-]=C\C=C\CCC[C@@H](C)O[Si](C)(C)C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/C15H29OSi.CH3.Zn/c1-8-9-10-11-12-13-14(2)16-17(6,7)15(3,4)5;;/h1,8-10,14H,11-13H2,2-7H3;1H3;/q2*-1;+2/b10-9+;;/t14-;;/m1../s1 |
| InChIKey | YIHMYTAAMHQDQQ-UVXWEWESSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide?
The IUPAC name of zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide (CID 177442884) is zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide.
What is the SMILES notation for zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide?
The canonical SMILES for zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide is [CH3-].[H]/[C-]=C\C=C\CCC[C@@H](C)O[Si](C)(C)C(C)(C)C.[Zn+2].
What is the InChIKey of zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide?
The InChIKey is YIHMYTAAMHQDQQ-UVXWEWESSA-N. The full InChI is InChI=1S/C15H29OSi.CH3.Zn/c1-8-9-10-11-12-13-14(2)16-17(6,7)15(3,4)5;;/h1,8-10,14H,11-13H2,2-7H3;1H3;/q2*-1;+2/b10-9+;;/t14-;;/m1../s1.
What are the key properties of zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide?
zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide has a molecular weight of 333.91 g/mol, XLogP of 5.56, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide is sourced from PubChem (CID 177442884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).