C16H32OSiZn — CID 177442884
zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide (PubChem CID 177442884) has the molecular formula C16H32OSiZn and a molecular weight of 333.91 g/mol. Its IUPAC name is zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide.
| Compound Name | zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide |
|---|---|
| PubChem CID | 177442884 |
| Molecular Formula | C16H32OSiZn |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | zinc;tert-butyl-dimethyl-[(2R,6E)-nona-6,8-dien-2-yl]oxysilane;carbanide |
| SMILES | [CH3-].[H]/[C-]=C\C=C\CCC[C@@H](C)O[Si](C)(C)C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/C15H29OSi.CH3.Zn/c1-8-9-10-11-12-13-14(2)16-17(6,7)15(3,4)5;;/h1,8-10,14H,11-13H2,2-7H3;1H3;/q2*-1;+2/b10-9+;;/t14-;;/m1../s1 |
| InChIKey | YIHMYTAAMHQDQQ-UVXWEWESSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|