C20H38O3Si — CID 25241738
ethyl (2E,4E,11R)-11-[tert-butyl(dimethyl)silyl]oxydodeca-2,4-dienoate (PubChem CID 25241738) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is ethyl (2E,4E,11R)-11-[tert-butyl(dimethyl)silyl]oxydodeca-2,4-dienoate.
| Compound Name | ethyl (2E,4E,11R)-11-[tert-butyl(dimethyl)silyl]oxydodeca-2,4-dienoate |
|---|---|
| PubChem CID | 25241738 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | ethyl (2E,4E,11R)-11-[tert-butyl(dimethyl)silyl]oxydodeca-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/CCCCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-8-22-19(21)17-15-13-11-9-10-12-14-16-18(2)23-24(6,7)20(3,4)5/h11,13,15,17-18H,8-10,12,14,16H2,1-7H3/b13-11+,17-15+/t18-/m1/s1 |
| InChIKey | PVHRZDPMLHVCSB-PQDVUVJTSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|