C17H32OSi — CID 11004320
tert-butyl-dimethyl-[(2R,6E,8E)-undeca-6,8,10-trien-2-yl]oxysilane (PubChem CID 11004320) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,6E,8E)-undeca-6,8,10-trien-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,6E,8E)-undeca-6,8,10-trien-2-yl]oxysilane |
|---|---|
| PubChem CID | 11004320 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,6E,8E)-undeca-6,8,10-trien-2-yl]oxysilane |
| SMILES | C=C/C=C/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32OSi/c1-8-9-10-11-12-13-14-15-16(2)18-19(6,7)17(3,4)5/h8-12,16H,1,13-15H2,2-7H3/b10-9+,12-11+/t16-/m1/s1 |
| InChIKey | MMSDMAXPVOJQJP-ACSYMRAHSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|