C16H28O5Si — CID 134931361
6-[(Z,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybut-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 134931361) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is 6-[(Z,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybut-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(Z,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybut-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 134931361 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 6-[(Z,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybut-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(C[C@@H](O)/C=C\O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H28O5Si/c1-15(2,3)22(6,7)19-9-8-12(17)10-13-11-14(18)21-16(4,5)20-13/h8-9,11-12,17H,10H2,1-7H3/b9-8-/t12-/m0/s1 |
| InChIKey | UEJUDQVFVWPOOX-LAUAKBEESA-N |
| XLogP | 3.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|