C36H56O6Si2 — CID 16750622
6-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5-dimethylhexyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 16750622) has the molecular formula C36H56O6Si2 and a molecular weight of 641.01 g/mol. Its IUPAC name is 6-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5-dimethylhexyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5-dimethylhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 16750622 |
| Molecular Formula | C36H56O6Si2 |
| Molecular Weight | 641.01 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | 6-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5-dimethylhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C36H56O6Si2/c1-26(25-39-44(35(6,7)8,29-19-15-13-16-20-29)30-21-17-14-18-22-30)33(42-43(11,12)34(3,4)5)27(2)31(37)23-28-24-32(38)41-36(9,10)40-28/h13-22,24,26-27,31,33,37H,23,25H2,1-12H3/t26-,27-,31+,33+/m0/s1 |
| InChIKey | VUAQJDGBLPETGN-HYQQJROOSA-N |
| XLogP | 7.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.01 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|