C43H76O5Si3 — CID 23246877
(5R,6S,7R,8S,9S,10R)-9-[tert-butyl(dimethyl)silyl]oxy-11-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,6,8,10-tetramethyl-7-triethylsilyloxyundecan-3-one (PubChem CID 23246877) has the molecular formula C43H76O5Si3 and a molecular weight of 757.33 g/mol. Its IUPAC name is (5R,6S,7R,8S,9S,10R)-9-[tert-butyl(dimethyl)silyl]oxy-11-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,6,8,10-tetramethyl-7-triethylsilyloxyundecan-3-one.
| Compound Name | (5R,6S,7R,8S,9S,10R)-9-[tert-butyl(dimethyl)silyl]oxy-11-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,6,8,10-tetramethyl-7-triethylsilyloxyundecan-3-one |
|---|---|
| PubChem CID | 23246877 |
| Molecular Formula | C43H76O5Si3 |
| Molecular Weight | 757.33 g/mol |
| Exact Mass | 756.50 |
| IUPAC Name | (5R,6S,7R,8S,9S,10R)-9-[tert-butyl(dimethyl)silyl]oxy-11-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-2,6,8,10-tetramethyl-7-triethylsilyloxyundecan-3-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)[C@H](O)CC(=O)C(C)C |
| InChI | InChI=1S/C43H76O5Si3/c1-17-50(18-2,19-3)48-41(34(7)39(45)30-38(44)32(4)5)35(8)40(47-49(15,16)42(9,10)11)33(6)31-46-51(43(12,13)14,36-26-22-20-23-27-36)37-28-24-21-25-29-37/h20-29,32-35,39-41,45H,17-19,30-31H2,1-16H3/t33-,34+,35+,39-,40+,41-/m1/s1 |
| InChIKey | INSKSTUEFBFFPP-JVMCKFPKSA-N |
| XLogP | 10.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.33 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|