C31H52O3Si2 — CID 54753539
(4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-5-triethylsilyloxyheptan-1-ol (PubChem CID 54753539) has the molecular formula C31H52O3Si2 and a molecular weight of 528.93 g/mol. Its IUPAC name is (4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-5-triethylsilyloxyheptan-1-ol.
| Compound Name | (4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-5-triethylsilyloxyheptan-1-ol |
|---|---|
| PubChem CID | 54753539 |
| Molecular Formula | C31H52O3Si2 |
| Molecular Weight | 528.93 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | (4S,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-5-triethylsilyloxyheptan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)CCCO)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H52O3Si2/c1-9-35(10-2,11-3)34-30(26(4)19-18-24-32)27(5)25-33-36(31(6,7)8,28-20-14-12-15-21-28)29-22-16-13-17-23-29/h12-17,20-23,26-27,30,32H,9-11,18-19,24-25H2,1-8H3/t26-,27-,30-/m0/s1 |
| InChIKey | ZYYVYLTZCLSEIU-VWYPKUQYSA-N |
| XLogP | 7.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.93 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|