C38H64O4Si2 — CID 102465380
(E,2S,3S,4R,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyldodec-5-ene-3,7-diol (PubChem CID 102465380) has the molecular formula C38H64O4Si2 and a molecular weight of 641.10 g/mol. Its IUPAC name is (E,2S,3S,4R,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyldodec-5-ene-3,7-diol.
| Compound Name | (E,2S,3S,4R,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyldodec-5-ene-3,7-diol |
|---|---|
| PubChem CID | 102465380 |
| Molecular Formula | C38H64O4Si2 |
| Molecular Weight | 641.10 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | (E,2S,3S,4R,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-1-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyldodec-5-ene-3,7-diol |
| SMILES | CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)/C(C)=C/[C@@H](C)[C@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H64O4Si2/c1-14-21-34(42-43(12,13)37(6,7)8)31(5)36(40)29(3)26-28(2)35(39)30(4)27-41-44(38(9,10)11,32-22-17-15-18-23-32)33-24-19-16-20-25-33/h15-20,22-26,28,30-31,34-36,39-40H,14,21,27H2,1-13H3/b29-26+/t28-,30+,31+,34+,35+,36+/m1/s1 |
| InChIKey | COOXATJCSMDGET-ZHMRFXCWSA-N |
| XLogP | 8.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.10 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|