C36H50O4Si — CID 102175420
(E,2S,3R,4R,8S)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyl-3-phenylmethoxynon-5-ene-1,7-diol (PubChem CID 102175420) has the molecular formula C36H50O4Si and a molecular weight of 574.88 g/mol. Its IUPAC name is (E,2S,3R,4R,8S)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyl-3-phenylmethoxynon-5-ene-1,7-diol.
| Compound Name | (E,2S,3R,4R,8S)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyl-3-phenylmethoxynon-5-ene-1,7-diol |
|---|---|
| PubChem CID | 102175420 |
| Molecular Formula | C36H50O4Si |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | (E,2S,3R,4R,8S)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethyl-3-phenylmethoxynon-5-ene-1,7-diol |
| SMILES | C/C(=C\[C@@H](C)[C@@H](OCc1ccccc1)[C@@H](C)CO)C(O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H50O4Si/c1-27(23-28(2)35(29(3)24-37)39-26-31-17-11-8-12-18-31)34(38)30(4)25-40-41(36(5,6)7,32-19-13-9-14-20-32)33-21-15-10-16-22-33/h8-23,28-30,34-35,37-38H,24-26H2,1-7H3/b27-23+/t28-,29+,30+,34?,35-/m1/s1 |
| InChIKey | RHLZCFDWIABBTG-MKHKTXIRSA-N |
| XLogP | 6.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|