C14H16O4 — CID 6710162
6-(2-hydroxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 6710162) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 6-(2-hydroxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-(2-hydroxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 6710162 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 6-(2-hydroxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(CC(O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H16O4/c1-14(2)17-11(9-13(16)18-14)8-12(15)10-6-4-3-5-7-10/h3-7,9,12,15H,8H2,1-2H3 |
| InChIKey | FMAQRTJXTXWTHB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |