C12H16O5 — CID 24864800
6-[(2S)-2-hydroxy-4-oxohex-5-enyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 24864800) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 6-[(2S)-2-hydroxy-4-oxohex-5-enyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2S)-2-hydroxy-4-oxohex-5-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 24864800 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 6-[(2S)-2-hydroxy-4-oxohex-5-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C=CC(=O)C[C@@H](O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C12H16O5/c1-4-8(13)5-9(14)6-10-7-11(15)17-12(2,3)16-10/h4,7,9,14H,1,5-6H2,2-3H3/t9-/m1/s1 |
| InChIKey | JKRLWNISMOWKQS-SECBINFHSA-N |
| XLogP | 1.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|