C27H40O10 — CID 50916554
(E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-7-[(4S,5S)-5-[(Z,5S)-1-(ethoxymethoxy)-5-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-ene-2,4-dione (PubChem CID 50916554) has the molecular formula C27H40O10 and a molecular weight of 524.61 g/mol. Its IUPAC name is (E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-7-[(4S,5S)-5-[(Z,5S)-1-(ethoxymethoxy)-5-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-ene-2,4-dione.
| Compound Name | (E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-7-[(4S,5S)-5-[(Z,5S)-1-(ethoxymethoxy)-5-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-ene-2,4-dione |
|---|---|
| PubChem CID | 50916554 |
| Molecular Formula | C27H40O10 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-7-[(4S,5S)-5-[(Z,5S)-1-(ethoxymethoxy)-5-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-5-ene-2,4-dione |
| SMILES | CCOCOC(/C=C\C[C@H](C)O)[C@H]1OC(C)(C)O[C@H]1C/C=C/C(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C27H40O10/c1-7-32-17-33-22(12-8-10-18(2)28)25-23(35-27(5,6)37-25)13-9-11-19(29)14-20(30)15-21-16-24(31)36-26(3,4)34-21/h8-9,11-12,16,18,22-23,25,28H,7,10,13-15,17H2,1-6H3/b11-9+,12-8-/t18-,22?,23-,25+/m0/s1 |
| InChIKey | HLMVWYRDBYEOHG-QTUPVHFQSA-N |
| XLogP | 3.27 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|