C26H38O10 — CID 102265169
(E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-[(4S,5R)-5-[(Z,5S)-5-hydroxy-1-(2-methoxyethoxy)hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-ene-1,3-dione (PubChem CID 102265169) has the molecular formula C26H38O10 and a molecular weight of 510.58 g/mol. Its IUPAC name is (E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-[(4S,5R)-5-[(Z,5S)-5-hydroxy-1-(2-methoxyethoxy)hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-ene-1,3-dione.
| Compound Name | (E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-[(4S,5R)-5-[(Z,5S)-5-hydroxy-1-(2-methoxyethoxy)hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 102265169 |
| Molecular Formula | C26H38O10 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (E)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-[(4S,5R)-5-[(Z,5S)-5-hydroxy-1-(2-methoxyethoxy)hex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-ene-1,3-dione |
| SMILES | COCCOC(/C=C\C[C@H](C)O)[C@@H]1OC(C)(C)O[C@H]1C/C=C/C(=O)CC(=O)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C26H38O10/c1-17(27)9-7-11-20(32-14-13-31-6)24-21(33-26(4,5)36-24)12-8-10-18(28)15-19(29)22-16-23(30)35-25(2,3)34-22/h7-8,10-11,16-17,20-21,24,27H,9,12-15H2,1-6H3/b10-8+,11-7-/t17-,20?,21-,24-/m0/s1 |
| InChIKey | UPRGGQVGRJZECJ-VTHLLPMXSA-N |
| XLogP | 2.53 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|