C16H24O8 — CID 10807380
(E,5R,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)-4-oxooct-2-enoic acid (PubChem CID 10807380) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is (E,5R,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)-4-oxooct-2-enoic acid.
| Compound Name | (E,5R,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)-4-oxooct-2-enoic acid |
|---|---|
| PubChem CID | 10807380 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (E,5R,7R)-7-[(E,5R)-5-hydroxyhex-2-enoyl]oxy-5-(methoxymethoxy)-4-oxooct-2-enoic acid |
| SMILES | COCO[C@H](C[C@@H](C)OC(=O)/C=C/C[C@@H](C)O)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H24O8/c1-11(17)5-4-6-16(21)24-12(2)9-14(23-10-22-3)13(18)7-8-15(19)20/h4,6-8,11-12,14,17H,5,9-10H2,1-3H3,(H,19,20)/b6-4+,8-7+/t11-,12-,14-/m1/s1 |
| InChIKey | VSPJZELMIOGUPA-WOYYAFRCSA-N |
| XLogP | 0.83 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|