C16H26O6 — CID 87869498
5-[5-(3-hydroxybutoxy)hex-2-enoyloxy]hex-2-enoic acid (PubChem CID 87869498) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 5-[5-(3-hydroxybutoxy)hex-2-enoyloxy]hex-2-enoic acid.
| Compound Name | 5-[5-(3-hydroxybutoxy)hex-2-enoyloxy]hex-2-enoic acid |
|---|---|
| PubChem CID | 87869498 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-[5-(3-hydroxybutoxy)hex-2-enoyloxy]hex-2-enoic acid |
| SMILES | CC(O)CCOC(C)CC=CC(=O)OC(C)CC=CC(=O)O |
| InChI | InChI=1S/C16H26O6/c1-12(17)10-11-21-13(2)6-5-9-16(20)22-14(3)7-4-8-15(18)19/h4-5,8-9,12-14,17H,6-7,10-11H2,1-3H3,(H,18,19) |
| InChIKey | QKKDYUVEOVZIOH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|