C12H24O3Si — CID 11149233
(E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoic acid (PubChem CID 11149233) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoic acid.
| Compound Name | (E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoic acid |
|---|---|
| PubChem CID | 11149233 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (E,5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoic acid |
| SMILES | C[C@@H](C/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-10(8-7-9-11(13)14)15-16(5,6)12(2,3)4/h7,9-10H,8H2,1-6H3,(H,13,14)/b9-7+/t10-/m0/s1 |
| InChIKey | DAHNOIMDEUNRHA-PCYYEKQGSA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|