C16H22O7 — CID 11393219
[(E,2S)-3,6-dioxohex-4-en-2-yl] (E,5S)-5-[(3R)-3-hydroxybutanoyl]oxyhex-2-enoate (PubChem CID 11393219) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is [(E,2S)-3,6-dioxohex-4-en-2-yl] (E,5S)-5-[(3R)-3-hydroxybutanoyl]oxyhex-2-enoate.
| Compound Name | [(E,2S)-3,6-dioxohex-4-en-2-yl] (E,5S)-5-[(3R)-3-hydroxybutanoyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 11393219 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(E,2S)-3,6-dioxohex-4-en-2-yl] (E,5S)-5-[(3R)-3-hydroxybutanoyl]oxyhex-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/C[C@H](C)OC(=O)C[C@@H](C)O)C(=O)/C=C/C=O |
| InChI | InChI=1S/C16H22O7/c1-11(18)10-16(21)22-12(2)6-4-8-15(20)23-13(3)14(19)7-5-9-17/h4-5,7-9,11-13,18H,6,10H2,1-3H3/b7-5+,8-4+/t11-,12+,13+/m1/s1 |
| InChIKey | QNUNBSDFUKUBGN-TVHSGCSMSA-N |
| XLogP | 0.89 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|